C13H12ClIN2O — CID 62128836
2-(4-chloro-3,5-dimethylpyrazol-1-yl)-1-(4-iodophenyl)ethanone (PubChem CID 62128836) has the molecular formula C13H12ClIN2O and a molecular weight of 374.61 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylpyrazol-1-yl)-1-(4-iodophenyl)ethanone.
| Compound Name | 2-(4-chloro-3,5-dimethylpyrazol-1-yl)-1-(4-iodophenyl)ethanone |
|---|---|
| PubChem CID | 62128836 |
| Molecular Formula | C13H12ClIN2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylpyrazol-1-yl)-1-(4-iodophenyl)ethanone |
| SMILES | Cc1nn(CC(=O)c2ccc(I)cc2)c(C)c1Cl |
| InChI | InChI=1S/C13H12ClIN2O/c1-8-13(14)9(2)17(16-8)7-12(18)10-3-5-11(15)6-4-10/h3-6H,7H2,1-2H3 |
| InChIKey | FCNBDFGAQXKWQY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|