C15H26N2 — CID 62129455
4-(aminomethyl)-N-(3,3-dimethylbutan-2-yl)-N,3-dimethylaniline (PubChem CID 62129455) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(3,3-dimethylbutan-2-yl)-N,3-dimethylaniline.
| Compound Name | 4-(aminomethyl)-N-(3,3-dimethylbutan-2-yl)-N,3-dimethylaniline |
|---|---|
| PubChem CID | 62129455 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 4-(aminomethyl)-N-(3,3-dimethylbutan-2-yl)-N,3-dimethylaniline |
| SMILES | Cc1cc(N(C)C(C)C(C)(C)C)ccc1CN |
| InChI | InChI=1S/C15H26N2/c1-11-9-14(8-7-13(11)10-16)17(6)12(2)15(3,4)5/h7-9,12H,10,16H2,1-6H3 |
| InChIKey | VMIIXPQIDNPIAP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|