About 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole
4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole (PubChem CID 62129771) has the molecular formula C10H11BrN2S
and a molecular weight of 271.18 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole.
Molecular Properties
| Compound Name | 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole |
| PubChem CID | 62129771 |
| Molecular Formula | C10H11BrN2S |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole |
| SMILES | Cc1nn(Cc2cccs2)c(C)c1Br |
| InChI | InChI=1S/C10H11BrN2S/c1-7-10(11)8(2)13(12-7)6-9-4-3-5-14-9/h3-5H,6H2,1-2H3 |
| InChIKey | LVRUROKRFDXFTE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole?
The IUPAC name of 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole (CID 62129771) is 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole.
What is the SMILES notation for 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole?
The canonical SMILES for 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole is Cc1nn(Cc2cccs2)c(C)c1Br.
What is the InChIKey of 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole?
The InChIKey is LVRUROKRFDXFTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2S/c1-7-10(11)8(2)13(12-7)6-9-4-3-5-14-9/h3-5H,6H2,1-2H3.
What are the key properties of 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole?
4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole has a molecular weight of 271.18 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,5-dimethyl-1-(thiophen-2-ylmethyl)pyrazole is sourced from PubChem (CID 62129771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).