About [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine
[2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine (PubChem CID 62129889) has the molecular formula C12H14BrN3
and a molecular weight of 280.17 g/mol. Its IUPAC name is [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine |
| PubChem CID | 62129889 |
| Molecular Formula | C12H14BrN3 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine |
| SMILES | Cc1nn(-c2ccccc2CN)c(C)c1Br |
| InChI | InChI=1S/C12H14BrN3/c1-8-12(13)9(2)16(15-8)11-6-4-3-5-10(11)7-14/h3-6H,7,14H2,1-2H3 |
| InChIKey | PCDVGAYXRRPGLT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine?
The IUPAC name of [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine (CID 62129889) is [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine.
What is the SMILES notation for [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine?
The canonical SMILES for [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine is Cc1nn(-c2ccccc2CN)c(C)c1Br.
What is the InChIKey of [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine?
The InChIKey is PCDVGAYXRRPGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN3/c1-8-12(13)9(2)16(15-8)11-6-4-3-5-10(11)7-14/h3-6H,7,14H2,1-2H3.
What are the key properties of [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine?
[2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine has a molecular weight of 280.17 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]methanamine is sourced from PubChem (CID 62129889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).