C13H17ClN2 — CID 62130145
3-[4-(chloromethyl)-N,3-dimethylanilino]-2-methylpropanenitrile (PubChem CID 62130145) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-N,3-dimethylanilino]-2-methylpropanenitrile.
| Compound Name | 3-[4-(chloromethyl)-N,3-dimethylanilino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 62130145 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3-[4-(chloromethyl)-N,3-dimethylanilino]-2-methylpropanenitrile |
| SMILES | Cc1cc(N(C)CC(C)C#N)ccc1CCl |
| InChI | InChI=1S/C13H17ClN2/c1-10(8-15)9-16(3)13-5-4-12(7-14)11(2)6-13/h4-6,10H,7,9H2,1-3H3 |
| InChIKey | SBYCHVNAVLUDGI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|