About 4-(chloromethyl)-N,N,3-trimethylaniline
4-(chloromethyl)-N,N,3-trimethylaniline (PubChem CID 62130656) has the molecular formula C10H14ClN
and a molecular weight of 183.68 g/mol. Its IUPAC name is 4-(chloromethyl)-N,N,3-trimethylaniline.
Molecular Properties
| Compound Name | 4-(chloromethyl)-N,N,3-trimethylaniline |
| PubChem CID | 62130656 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4-(chloromethyl)-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1CCl |
| InChI | InChI=1S/C10H14ClN/c1-8-6-10(12(2)3)5-4-9(8)7-11/h4-6H,7H2,1-3H3 |
| InChIKey | FDGMLAGOUNMASQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-N,N,3-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-N,N,3-trimethylaniline?
The IUPAC name of 4-(chloromethyl)-N,N,3-trimethylaniline (CID 62130656) is 4-(chloromethyl)-N,N,3-trimethylaniline.
What is the SMILES notation for 4-(chloromethyl)-N,N,3-trimethylaniline?
The canonical SMILES for 4-(chloromethyl)-N,N,3-trimethylaniline is Cc1cc(N(C)C)ccc1CCl.
What is the InChIKey of 4-(chloromethyl)-N,N,3-trimethylaniline?
The InChIKey is FDGMLAGOUNMASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN/c1-8-6-10(12(2)3)5-4-9(8)7-11/h4-6H,7H2,1-3H3.
What are the key properties of 4-(chloromethyl)-N,N,3-trimethylaniline?
4-(chloromethyl)-N,N,3-trimethylaniline has a molecular weight of 183.68 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-N,N,3-trimethylaniline is sourced from PubChem (CID 62130656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).