C11H13N3O2S3 — CID 62133066
4-[(1,1-dioxothiolan-3-yl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 62133066) has the molecular formula C11H13N3O2S3 and a molecular weight of 315.44 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62133066 |
| Molecular Formula | C11H13N3O2S3 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)methyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | O=S1(=O)CCC(Cn2c(-c3cccs3)n[nH]c2=S)C1 |
| InChI | InChI=1S/C11H13N3O2S3/c15-19(16)5-3-8(7-19)6-14-10(12-13-11(14)17)9-2-1-4-18-9/h1-2,4,8H,3,5-7H2,(H,13,17) |
| InChIKey | RSPWCOCQFFXFOK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|