C10H19N3O — CID 62133297
4-methyl-2-[(1-methylimidazol-2-yl)amino]pentan-1-ol (PubChem CID 62133297) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-methyl-2-[(1-methylimidazol-2-yl)amino]pentan-1-ol.
| Compound Name | 4-methyl-2-[(1-methylimidazol-2-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 62133297 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 4-methyl-2-[(1-methylimidazol-2-yl)amino]pentan-1-ol |
| SMILES | CC(C)CC(CO)Nc1nccn1C |
| InChI | InChI=1S/C10H19N3O/c1-8(2)6-9(7-14)12-10-11-4-5-13(10)3/h4-5,8-9,14H,6-7H2,1-3H3,(H,11,12) |
| InChIKey | OKZVICNUVHRPJW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |