C12H17NO3 — CID 62133714
2-(aminomethyl)-3-(4-methoxy-3-methylphenyl)propanoic acid (PubChem CID 62133714) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(4-methoxy-3-methylphenyl)propanoic acid.
| Compound Name | 2-(aminomethyl)-3-(4-methoxy-3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 62133714 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(aminomethyl)-3-(4-methoxy-3-methylphenyl)propanoic acid |
| SMILES | COc1ccc(CC(CN)C(=O)O)cc1C |
| InChI | InChI=1S/C12H17NO3/c1-8-5-9(3-4-11(8)16-2)6-10(7-13)12(14)15/h3-5,10H,6-7,13H2,1-2H3,(H,14,15) |
| InChIKey | TZIRNUSXXUHABX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |