C15H17FN2 — CID 62134095
N-[(4-fluoro-2-methylphenyl)methyl]-2-pyridin-4-ylethanamine (PubChem CID 62134095) has the molecular formula C15H17FN2 and a molecular weight of 244.31 g/mol. Its IUPAC name is N-[(4-fluoro-2-methylphenyl)methyl]-2-pyridin-4-ylethanamine.
| Compound Name | N-[(4-fluoro-2-methylphenyl)methyl]-2-pyridin-4-ylethanamine |
|---|---|
| PubChem CID | 62134095 |
| Molecular Formula | C15H17FN2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | N-[(4-fluoro-2-methylphenyl)methyl]-2-pyridin-4-ylethanamine |
| SMILES | Cc1cc(F)ccc1CNCCc1ccncc1 |
| InChI | InChI=1S/C15H17FN2/c1-12-10-15(16)3-2-14(12)11-18-9-6-13-4-7-17-8-5-13/h2-5,7-8,10,18H,6,9,11H2,1H3 |
| InChIKey | VUTVXWHACFWAPY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|