C14H21NO — CID 62134365
[4-(2-ethylpyrrolidin-1-yl)-2-methylphenyl]methanol (PubChem CID 62134365) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is [4-(2-ethylpyrrolidin-1-yl)-2-methylphenyl]methanol.
| Compound Name | [4-(2-ethylpyrrolidin-1-yl)-2-methylphenyl]methanol |
|---|---|
| PubChem CID | 62134365 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | [4-(2-ethylpyrrolidin-1-yl)-2-methylphenyl]methanol |
| SMILES | CCC1CCCN1c1ccc(CO)c(C)c1 |
| InChI | InChI=1S/C14H21NO/c1-3-13-5-4-8-15(13)14-7-6-12(10-16)11(2)9-14/h6-7,9,13,16H,3-5,8,10H2,1-2H3 |
| InChIKey | YPXCMBMDUDRUFK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|