C14H18N2O2 — CID 62135938
N-cyclopropyl-2-(4-formyl-N,3-dimethylanilino)acetamide (PubChem CID 62135938) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-cyclopropyl-2-(4-formyl-N,3-dimethylanilino)acetamide.
| Compound Name | N-cyclopropyl-2-(4-formyl-N,3-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 62135938 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-cyclopropyl-2-(4-formyl-N,3-dimethylanilino)acetamide |
| SMILES | Cc1cc(N(C)CC(=O)NC2CC2)ccc1C=O |
| InChI | InChI=1S/C14H18N2O2/c1-10-7-13(6-3-11(10)9-17)16(2)8-14(18)15-12-4-5-12/h3,6-7,9,12H,4-5,8H2,1-2H3,(H,15,18) |
| InChIKey | YWLZIWLKVMXINJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|