C14H15N3OS — CID 62136899
3-[5-(1-benzothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-N-methylpropan-1-amine (PubChem CID 62136899) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-[5-(1-benzothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[5-(1-benzothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 62136899 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-[5-(1-benzothiophen-3-yl)-1,3,4-oxadiazol-2-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1nnc(-c2csc3ccccc23)o1 |
| InChI | InChI=1S/C14H15N3OS/c1-15-8-4-7-13-16-17-14(18-13)11-9-19-12-6-3-2-5-10(11)12/h2-3,5-6,9,15H,4,7-8H2,1H3 |
| InChIKey | OJDCJKSURGYDBD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|