C22H27N3O — CID 6213753
[3-(dimethylamino)phenyl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone (PubChem CID 6213753) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is [3-(dimethylamino)phenyl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone.
| Compound Name | [3-(dimethylamino)phenyl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 6213753 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | [3-(dimethylamino)phenyl]-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
| SMILES | CN(C)c1cccc(C(=O)N2CCN(C/C=C/c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H27N3O/c1-23(2)21-12-6-11-20(18-21)22(26)25-16-14-24(15-17-25)13-7-10-19-8-4-3-5-9-19/h3-12,18H,13-17H2,1-2H3/b10-7+ |
| InChIKey | RPUNIBRPNDYTTF-JXMROGBWSA-N |
| XLogP | 3.22 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |