About N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine
N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine (PubChem CID 62138324) has the molecular formula C7H9F2N3O
and a molecular weight of 189.16 g/mol. Its IUPAC name is N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine |
| PubChem CID | 62138324 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine |
| SMILES | FC(F)c1nnc(CNC2CC2)o1 |
| InChI | InChI=1S/C7H9F2N3O/c8-6(9)7-12-11-5(13-7)3-10-4-1-2-4/h4,6,10H,1-3H2 |
| InChIKey | KARLWRPXBZFALB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine?
The IUPAC name of N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine (CID 62138324) is N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine?
The canonical SMILES for N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine is FC(F)c1nnc(CNC2CC2)o1.
What is the InChIKey of N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine?
The InChIKey is KARLWRPXBZFALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N3O/c8-6(9)7-12-11-5(13-7)3-10-4-1-2-4/h4,6,10H,1-3H2.
What are the key properties of N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine?
N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine has a molecular weight of 189.16 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methyl]cyclopropanamine is sourced from PubChem (CID 62138324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).