C9H15N3O — CID 62139591
N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine (PubChem CID 62139591) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62139591 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(C2CC2)o1 |
| InChI | InChI=1S/C9H15N3O/c1-2-5-10-6-8-11-12-9(13-8)7-3-4-7/h7,10H,2-6H2,1H3 |
| InChIKey | JNLQJMQDFYTMCO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|