C26H25NO7 — CID 621399
(2-acetamido-1,4-diacetyloxy-1,2,3,4-tetrahydrobenzo[g]phenanthren-3-yl) acetate (PubChem CID 621399) has the molecular formula C26H25NO7 and a molecular weight of 463.49 g/mol. Its IUPAC name is (2-acetamido-1,4-diacetyloxy-1,2,3,4-tetrahydrobenzo[g]phenanthren-3-yl) acetate.
| Compound Name | (2-acetamido-1,4-diacetyloxy-1,2,3,4-tetrahydrobenzo[g]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 621399 |
| Molecular Formula | C26H25NO7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (2-acetamido-1,4-diacetyloxy-1,2,3,4-tetrahydrobenzo[g]phenanthren-3-yl) acetate |
| SMILES | CC(=O)NC1C(OC(C)=O)c2c(ccc3ccc4ccccc4c23)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C26H25NO7/c1-13(28)27-23-25(33-15(3)30)22-20(24(32-14(2)29)26(23)34-16(4)31)12-11-18-10-9-17-7-5-6-8-19(17)21(18)22/h5-12,23-26H,1-4H3,(H,27,28) |
| InChIKey | AONMTZLFSJSUOH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|