C15H21NO3 — CID 62140295
3-cyclobutyloxy-2-(ethylamino)-2-phenylpropanoic acid (PubChem CID 62140295) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-cyclobutyloxy-2-(ethylamino)-2-phenylpropanoic acid.
| Compound Name | 3-cyclobutyloxy-2-(ethylamino)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 62140295 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-cyclobutyloxy-2-(ethylamino)-2-phenylpropanoic acid |
| SMILES | CCNC(COC1CCC1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c1-2-16-15(14(17)18,11-19-13-9-6-10-13)12-7-4-3-5-8-12/h3-5,7-8,13,16H,2,6,9-11H2,1H3,(H,17,18) |
| InChIKey | RMVJYZBUYLGBDR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |