About 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine
2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine (PubChem CID 62141386) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine |
| PubChem CID | 62141386 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine |
| SMILES | CCNC1CCC(CC)CC1OC1CCC1 |
| InChI | InChI=1S/C14H27NO/c1-3-11-8-9-13(15-4-2)14(10-11)16-12-6-5-7-12/h11-15H,3-10H2,1-2H3 |
| InChIKey | WILKLOWPWCMHNM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine?
The IUPAC name of 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine (CID 62141386) is 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine.
What is the SMILES notation for 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine?
The canonical SMILES for 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine is CCNC1CCC(CC)CC1OC1CCC1.
What is the InChIKey of 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine?
The InChIKey is WILKLOWPWCMHNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-3-11-8-9-13(15-4-2)14(10-11)16-12-6-5-7-12/h11-15H,3-10H2,1-2H3.
What are the key properties of 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine?
2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine has a molecular weight of 225.38 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyloxy-N,4-diethylcyclohexan-1-amine is sourced from PubChem (CID 62141386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).