About 2-indazol-1-ylethanamine
2-indazol-1-ylethanamine (PubChem CID 62141666) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 2-indazol-1-ylethanamine.
Molecular Properties
| Compound Name | 2-indazol-1-ylethanamine |
| PubChem CID | 62141666 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-indazol-1-ylethanamine |
| SMILES | NCCn1ncc2ccccc21 |
| InChI | InChI=1S/C9H11N3/c10-5-6-12-9-4-2-1-3-8(9)7-11-12/h1-4,7H,5-6,10H2 |
| InChIKey | XSFRZUDEUZCCRO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-indazol-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-indazol-1-ylethanamine?
The IUPAC name of 2-indazol-1-ylethanamine (CID 62141666) is 2-indazol-1-ylethanamine.
What is the SMILES notation for 2-indazol-1-ylethanamine?
The canonical SMILES for 2-indazol-1-ylethanamine is NCCn1ncc2ccccc21.
What is the InChIKey of 2-indazol-1-ylethanamine?
The InChIKey is XSFRZUDEUZCCRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c10-5-6-12-9-4-2-1-3-8(9)7-11-12/h1-4,7H,5-6,10H2.
What are the key properties of 2-indazol-1-ylethanamine?
2-indazol-1-ylethanamine has a molecular weight of 161.21 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-indazol-1-ylethanamine is sourced from PubChem (CID 62141666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).