About 4-indazol-1-ylbutan-1-ol
4-indazol-1-ylbutan-1-ol (PubChem CID 62142094) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-indazol-1-ylbutan-1-ol.
Molecular Properties
| Compound Name | 4-indazol-1-ylbutan-1-ol |
| PubChem CID | 62142094 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-indazol-1-ylbutan-1-ol |
| SMILES | OCCCCn1ncc2ccccc21 |
| InChI | InChI=1S/C11H14N2O/c14-8-4-3-7-13-11-6-2-1-5-10(11)9-12-13/h1-2,5-6,9,14H,3-4,7-8H2 |
| InChIKey | NQZMZVYALQAUOD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-indazol-1-ylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-indazol-1-ylbutan-1-ol?
The IUPAC name of 4-indazol-1-ylbutan-1-ol (CID 62142094) is 4-indazol-1-ylbutan-1-ol.
What is the SMILES notation for 4-indazol-1-ylbutan-1-ol?
The canonical SMILES for 4-indazol-1-ylbutan-1-ol is OCCCCn1ncc2ccccc21.
What is the InChIKey of 4-indazol-1-ylbutan-1-ol?
The InChIKey is NQZMZVYALQAUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c14-8-4-3-7-13-11-6-2-1-5-10(11)9-12-13/h1-2,5-6,9,14H,3-4,7-8H2.
What are the key properties of 4-indazol-1-ylbutan-1-ol?
4-indazol-1-ylbutan-1-ol has a molecular weight of 190.25 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-indazol-1-ylbutan-1-ol is sourced from PubChem (CID 62142094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).