C13H20N4O2S — CID 62143492
N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(methylamino)pyridine-4-sulfonamide (PubChem CID 62143492) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(methylamino)pyridine-4-sulfonamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(methylamino)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 62143492 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(methylamino)pyridine-4-sulfonamide |
| SMILES | CNc1cc(S(=O)(=O)NC2CN3CCC2CC3)ccn1 |
| InChI | InChI=1S/C13H20N4O2S/c1-14-13-8-11(2-5-15-13)20(18,19)16-12-9-17-6-3-10(12)4-7-17/h2,5,8,10,12,16H,3-4,6-7,9H2,1H3,(H,14,15) |
| InChIKey | AMMKGVCPIIZKJT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |