About 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide
2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide (PubChem CID 62146624) has the molecular formula C8H11N5O3S2
and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide.
Molecular Properties
| Compound Name | 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide |
| PubChem CID | 62146624 |
| Molecular Formula | C8H11N5O3S2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1c(N)nc2sccn12)C(N)=O |
| InChI | InChI=1S/C8H11N5O3S2/c1-4(6(10)14)12-18(15,16)7-5(9)11-8-13(7)2-3-17-8/h2-4,12H,9H2,1H3,(H2,10,14) |
| InChIKey | VRWDSFUUSNUXDO-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 132.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide?
The IUPAC name of 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide (CID 62146624) is 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide.
What is the SMILES notation for 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide?
The canonical SMILES for 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide is CC(NS(=O)(=O)c1c(N)nc2sccn12)C(N)=O.
What is the InChIKey of 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide?
The InChIKey is VRWDSFUUSNUXDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O3S2/c1-4(6(10)14)12-18(15,16)7-5(9)11-8-13(7)2-3-17-8/h2-4,12H,9H2,1H3,(H2,10,14).
What are the key properties of 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide?
2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide has a molecular weight of 289.34 g/mol, XLogP of -0.87, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-aminoimidazo[2,1-b][1,3]thiazol-5-yl)sulfonylamino]propanamide is sourced from PubChem (CID 62146624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).