C11H19N3O4S2 — CID 62146808
4-(propylamino)-N-(2-sulfamoylethyl)benzenesulfonamide (PubChem CID 62146808) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-(propylamino)-N-(2-sulfamoylethyl)benzenesulfonamide.
| Compound Name | 4-(propylamino)-N-(2-sulfamoylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 62146808 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-(propylamino)-N-(2-sulfamoylethyl)benzenesulfonamide |
| SMILES | CCCNc1ccc(S(=O)(=O)NCCS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H19N3O4S2/c1-2-7-13-10-3-5-11(6-4-10)20(17,18)14-8-9-19(12,15)16/h3-6,13-14H,2,7-9H2,1H3,(H2,12,15,16) |
| InChIKey | PMVKLIJUPJMAKP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |