About 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline
2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline (PubChem CID 6214979) has the molecular formula C20H17NO2
and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline.
Molecular Properties
| Compound Name | 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline |
| PubChem CID | 6214979 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline |
| SMILES | Cc1ccc2nc(/C=C/c3ccc4c(c3)OCCO4)ccc2c1 |
| InChI | InChI=1S/C20H17NO2/c1-14-2-8-18-16(12-14)5-7-17(21-18)6-3-15-4-9-19-20(13-15)23-11-10-22-19/h2-9,12-13H,10-11H2,1H3/b6-3+ |
| InChIKey | PVYTXZBMNOCTRF-ZZXKWVIFSA-N |
| XLogP | 4.48 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline?
The IUPAC name of 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline (CID 6214979) is 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline.
What is the SMILES notation for 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline?
The canonical SMILES for 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline is Cc1ccc2nc(/C=C/c3ccc4c(c3)OCCO4)ccc2c1.
What is the InChIKey of 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline?
The InChIKey is PVYTXZBMNOCTRF-ZZXKWVIFSA-N. The full InChI is InChI=1S/C20H17NO2/c1-14-2-8-18-16(12-14)5-7-17(21-18)6-3-15-4-9-19-20(13-15)23-11-10-22-19/h2-9,12-13H,10-11H2,1H3/b6-3+.
What are the key properties of 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline?
2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline has a molecular weight of 303.36 g/mol, XLogP of 4.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-6-methylquinoline is sourced from PubChem (CID 6214979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).