About 2-amino-N,N-dimethylpyrimidine-5-sulfonamide
2-amino-N,N-dimethylpyrimidine-5-sulfonamide (PubChem CID 62150682) has the molecular formula C6H10N4O2S
and a molecular weight of 202.24 g/mol. Its IUPAC name is 2-amino-N,N-dimethylpyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-N,N-dimethylpyrimidine-5-sulfonamide |
| PubChem CID | 62150682 |
| Molecular Formula | C6H10N4O2S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-amino-N,N-dimethylpyrimidine-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cnc(N)nc1 |
| InChI | InChI=1S/C6H10N4O2S/c1-10(2)13(11,12)5-3-8-6(7)9-4-5/h3-4H,1-2H3,(H2,7,8,9) |
| InChIKey | ILNCCTXTXCJUFQ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N,N-dimethylpyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N-dimethylpyrimidine-5-sulfonamide?
The IUPAC name of 2-amino-N,N-dimethylpyrimidine-5-sulfonamide (CID 62150682) is 2-amino-N,N-dimethylpyrimidine-5-sulfonamide.
What is the SMILES notation for 2-amino-N,N-dimethylpyrimidine-5-sulfonamide?
The canonical SMILES for 2-amino-N,N-dimethylpyrimidine-5-sulfonamide is CN(C)S(=O)(=O)c1cnc(N)nc1.
What is the InChIKey of 2-amino-N,N-dimethylpyrimidine-5-sulfonamide?
The InChIKey is ILNCCTXTXCJUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2S/c1-10(2)13(11,12)5-3-8-6(7)9-4-5/h3-4H,1-2H3,(H2,7,8,9).
What are the key properties of 2-amino-N,N-dimethylpyrimidine-5-sulfonamide?
2-amino-N,N-dimethylpyrimidine-5-sulfonamide has a molecular weight of 202.24 g/mol, XLogP of -0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N-dimethylpyrimidine-5-sulfonamide is sourced from PubChem (CID 62150682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).