C9H15N3O2S — CID 62150875
2-amino-N,N-diethylpyridine-3-sulfonamide (PubChem CID 62150875) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-amino-N,N-diethylpyridine-3-sulfonamide.
| Compound Name | 2-amino-N,N-diethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62150875 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-N,N-diethylpyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccnc1N |
| InChI | InChI=1S/C9H15N3O2S/c1-3-12(4-2)15(13,14)8-6-5-7-11-9(8)10/h5-7H,3-4H2,1-2H3,(H2,10,11) |
| InChIKey | FKCLTDFHAYJCGL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |