C12H20N4O3S — CID 62151741
5-(3-propoxypiperidin-1-yl)sulfonylpyrimidin-2-amine (PubChem CID 62151741) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-(3-propoxypiperidin-1-yl)sulfonylpyrimidin-2-amine.
| Compound Name | 5-(3-propoxypiperidin-1-yl)sulfonylpyrimidin-2-amine |
|---|---|
| PubChem CID | 62151741 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-(3-propoxypiperidin-1-yl)sulfonylpyrimidin-2-amine |
| SMILES | CCCOC1CCCN(S(=O)(=O)c2cnc(N)nc2)C1 |
| InChI | InChI=1S/C12H20N4O3S/c1-2-6-19-10-4-3-5-16(9-10)20(17,18)11-7-14-12(13)15-8-11/h7-8,10H,2-6,9H2,1H3,(H2,13,14,15) |
| InChIKey | PZLNCFWVOUQAEM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |