C13H11N5O — CID 62154124
2-amino-N-(1H-pyrazol-4-yl)quinoline-4-carboxamide (PubChem CID 62154124) has the molecular formula C13H11N5O and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-amino-N-(1H-pyrazol-4-yl)quinoline-4-carboxamide.
| Compound Name | 2-amino-N-(1H-pyrazol-4-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 62154124 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-amino-N-(1H-pyrazol-4-yl)quinoline-4-carboxamide |
| SMILES | Nc1cc(C(=O)Nc2cn[nH]c2)c2ccccc2n1 |
| InChI | InChI=1S/C13H11N5O/c14-12-5-10(9-3-1-2-4-11(9)18-12)13(19)17-8-6-15-16-7-8/h1-7H,(H2,14,18)(H,15,16)(H,17,19) |
| InChIKey | PYWOTMVLHNIFPY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |