About 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide
6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide (PubChem CID 62154321) has the molecular formula C8H10ClN3O
and a molecular weight of 199.64 g/mol. Its IUPAC name is 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide |
| PubChem CID | 62154321 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1nc(N)ccc1Cl |
| InChI | InChI=1S/C8H10ClN3O/c1-12(2)8(13)7-5(9)3-4-6(10)11-7/h3-4H,1-2H3,(H2,10,11) |
| InChIKey | UUCAXYHSNGDLQC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide?
The IUPAC name of 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide (CID 62154321) is 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide.
What is the SMILES notation for 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide?
The canonical SMILES for 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide is CN(C)C(=O)c1nc(N)ccc1Cl.
What is the InChIKey of 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide?
The InChIKey is UUCAXYHSNGDLQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3O/c1-12(2)8(13)7-5(9)3-4-6(10)11-7/h3-4H,1-2H3,(H2,10,11).
What are the key properties of 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide?
6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide has a molecular weight of 199.64 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-chloro-N,N-dimethylpyridine-2-carboxamide is sourced from PubChem (CID 62154321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).