About 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one
4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 621552) has the molecular formula C17H14N2O
and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
| PubChem CID | 621552 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | O=C1CC(C=Cc2ccccc2)=Nc2ccccc2N1 |
| InChI | InChI=1S/C17H14N2O/c20-17-12-14(11-10-13-6-2-1-3-7-13)18-15-8-4-5-9-16(15)19-17/h1-11H,12H2,(H,19,20) |
| InChIKey | YXOTZFPASAWCAO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one?
The IUPAC name of 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one (CID 621552) is 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one.
What is the SMILES notation for 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one?
The canonical SMILES for 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one is O=C1CC(C=Cc2ccccc2)=Nc2ccccc2N1.
What is the InChIKey of 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one?
The InChIKey is YXOTZFPASAWCAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O/c20-17-12-14(11-10-13-6-2-1-3-7-13)18-15-8-4-5-9-16(15)19-17/h1-11H,12H2,(H,19,20).
What are the key properties of 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one?
4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one has a molecular weight of 262.31 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-phenylethenyl)-1,3-dihydro-1,5-benzodiazepin-2-one is sourced from PubChem (CID 621552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).