C13H9ClN4O — CID 62156588
6-amino-3-chloro-N-(3-cyanophenyl)pyridine-2-carboxamide (PubChem CID 62156588) has the molecular formula C13H9ClN4O and a molecular weight of 272.70 g/mol. Its IUPAC name is 6-amino-3-chloro-N-(3-cyanophenyl)pyridine-2-carboxamide.
| Compound Name | 6-amino-3-chloro-N-(3-cyanophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62156588 |
| Molecular Formula | C13H9ClN4O |
| Molecular Weight | 272.70 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-amino-3-chloro-N-(3-cyanophenyl)pyridine-2-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2nc(N)ccc2Cl)c1 |
| InChI | InChI=1S/C13H9ClN4O/c14-10-4-5-11(16)18-12(10)13(19)17-9-3-1-2-8(6-9)7-15/h1-6H,(H2,16,18)(H,17,19) |
| InChIKey | RQTRBCXXXYJTGW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |