C15H19N3O2S — CID 62157255
2-(methylamino)-N-(2-propylphenyl)pyridine-4-sulfonamide (PubChem CID 62157255) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-(methylamino)-N-(2-propylphenyl)pyridine-4-sulfonamide.
| Compound Name | 2-(methylamino)-N-(2-propylphenyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 62157255 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(methylamino)-N-(2-propylphenyl)pyridine-4-sulfonamide |
| SMILES | CCCc1ccccc1NS(=O)(=O)c1ccnc(NC)c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-3-6-12-7-4-5-8-14(12)18-21(19,20)13-9-10-17-15(11-13)16-2/h4-5,7-11,18H,3,6H2,1-2H3,(H,16,17) |
| InChIKey | MCLBZPFDUCSOSS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |