C13H15FN4O2S — CID 62157505
2-(ethylamino)-N-(4-fluorophenyl)-N-methylpyrimidine-5-sulfonamide (PubChem CID 62157505) has the molecular formula C13H15FN4O2S and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-(ethylamino)-N-(4-fluorophenyl)-N-methylpyrimidine-5-sulfonamide.
| Compound Name | 2-(ethylamino)-N-(4-fluorophenyl)-N-methylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62157505 |
| Molecular Formula | C13H15FN4O2S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-(ethylamino)-N-(4-fluorophenyl)-N-methylpyrimidine-5-sulfonamide |
| SMILES | CCNc1ncc(S(=O)(=O)N(C)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C13H15FN4O2S/c1-3-15-13-16-8-12(9-17-13)21(19,20)18(2)11-6-4-10(14)5-7-11/h4-9H,3H2,1-2H3,(H,15,16,17) |
| InChIKey | ORACNAAQMIHDPT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |