About N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide (PubChem CID 62158246) has the molecular formula C13H18N4O2S2
and a molecular weight of 326.45 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide |
| PubChem CID | 62158246 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)NC(C)c2cc(C)sc2C)cn1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-8-5-12(10(3)20-8)9(2)17-21(18,19)11-6-15-13(14-4)16-7-11/h5-7,9,17H,1-4H3,(H,14,15,16) |
| InChIKey | IBADBGASVCJDBT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide?
The IUPAC name of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide (CID 62158246) is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide.
What is the SMILES notation for N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide?
The canonical SMILES for N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide is CNc1ncc(S(=O)(=O)NC(C)c2cc(C)sc2C)cn1.
What is the InChIKey of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide?
The InChIKey is IBADBGASVCJDBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2S2/c1-8-5-12(10(3)20-8)9(2)17-21(18,19)11-6-15-13(14-4)16-7-11/h5-7,9,17H,1-4H3,(H,14,15,16).
What are the key properties of N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide?
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide has a molecular weight of 326.45 g/mol, XLogP of 2.24, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-2-(methylamino)pyrimidine-5-sulfonamide is sourced from PubChem (CID 62158246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).