About 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine
5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine (PubChem CID 62158336) has the molecular formula C12H20N4O3S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine |
| PubChem CID | 62158336 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine |
| SMILES | CCNc1ncc(S(=O)(=O)N2CCOCC2(C)C)cn1 |
| InChI | InChI=1S/C12H20N4O3S/c1-4-13-11-14-7-10(8-15-11)20(17,18)16-5-6-19-9-12(16,2)3/h7-8H,4-6,9H2,1-3H3,(H,13,14,15) |
| InChIKey | RTDFAIYWJXYRCA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine?
The IUPAC name of 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine (CID 62158336) is 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine.
What is the SMILES notation for 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine?
The canonical SMILES for 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine is CCNc1ncc(S(=O)(=O)N2CCOCC2(C)C)cn1.
What is the InChIKey of 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine?
The InChIKey is RTDFAIYWJXYRCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3S/c1-4-13-11-14-7-10(8-15-11)20(17,18)16-5-6-19-9-12(16,2)3/h7-8H,4-6,9H2,1-3H3,(H,13,14,15).
What are the key properties of 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine?
5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine has a molecular weight of 300.38 g/mol, XLogP of 0.71, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-N-ethylpyrimidin-2-amine is sourced from PubChem (CID 62158336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).