C11H14FN3O5S — CID 62158489
[1-(2-amino-6-fluoro-4-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 62158489) has the molecular formula C11H14FN3O5S and a molecular weight of 319.31 g/mol. Its IUPAC name is [1-(2-amino-6-fluoro-4-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [1-(2-amino-6-fluoro-4-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 62158489 |
| Molecular Formula | C11H14FN3O5S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | [1-(2-amino-6-fluoro-4-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | Nc1cc([N+](=O)[O-])cc(F)c1S(=O)(=O)N1CCCC1CO |
| InChI | InChI=1S/C11H14FN3O5S/c12-9-4-8(15(17)18)5-10(13)11(9)21(19,20)14-3-1-2-7(14)6-16/h4-5,7,16H,1-3,6,13H2 |
| InChIKey | HHMOITPUVGTKCT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|