C11H14N4O2S — CID 62159326
2-amino-N-(2-cyanoethyl)-N-cyclopropylpyridine-3-sulfonamide (PubChem CID 62159326) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-amino-N-(2-cyanoethyl)-N-cyclopropylpyridine-3-sulfonamide.
| Compound Name | 2-amino-N-(2-cyanoethyl)-N-cyclopropylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62159326 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-amino-N-(2-cyanoethyl)-N-cyclopropylpyridine-3-sulfonamide |
| SMILES | N#CCCN(C1CC1)S(=O)(=O)c1cccnc1N |
| InChI | InChI=1S/C11H14N4O2S/c12-6-2-8-15(9-4-5-9)18(16,17)10-3-1-7-14-11(10)13/h1,3,7,9H,2,4-5,8H2,(H2,13,14) |
| InChIKey | ITQNSLQSZYLVKN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |