C12H16ClN3O2 — CID 62159652
2-amino-6-chloro-N-(oxan-2-ylmethyl)pyridine-4-carboxamide (PubChem CID 62159652) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 2-amino-6-chloro-N-(oxan-2-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-(oxan-2-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62159652 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-amino-6-chloro-N-(oxan-2-ylmethyl)pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)NCC2CCCCO2)cc(Cl)n1 |
| InChI | InChI=1S/C12H16ClN3O2/c13-10-5-8(6-11(14)16-10)12(17)15-7-9-3-1-2-4-18-9/h5-6,9H,1-4,7H2,(H2,14,16)(H,15,17) |
| InChIKey | DVVUDWIVTJKMOX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|