C15H16BrN3O2 — CID 62160081
2-amino-5-bromo-N-[(2-methoxyphenyl)methyl]-N-methylpyridine-3-carboxamide (PubChem CID 62160081) has the molecular formula C15H16BrN3O2 and a molecular weight of 350.22 g/mol. Its IUPAC name is 2-amino-5-bromo-N-[(2-methoxyphenyl)methyl]-N-methylpyridine-3-carboxamide.
| Compound Name | 2-amino-5-bromo-N-[(2-methoxyphenyl)methyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 62160081 |
| Molecular Formula | C15H16BrN3O2 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2-amino-5-bromo-N-[(2-methoxyphenyl)methyl]-N-methylpyridine-3-carboxamide |
| SMILES | COc1ccccc1CN(C)C(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C15H16BrN3O2/c1-19(9-10-5-3-4-6-13(10)21-2)15(20)12-7-11(16)8-18-14(12)17/h3-8H,9H2,1-2H3,(H2,17,18) |
| InChIKey | PDPBPFGASVNKRL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |