C14H22O2 — CID 62161527
1-(2-methoxy-5-methylphenyl)-4-methylpentan-2-ol (PubChem CID 62161527) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-4-methylpentan-2-ol.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 62161527 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-4-methylpentan-2-ol |
| SMILES | COc1ccc(C)cc1CC(O)CC(C)C |
| InChI | InChI=1S/C14H22O2/c1-10(2)7-13(15)9-12-8-11(3)5-6-14(12)16-4/h5-6,8,10,13,15H,7,9H2,1-4H3 |
| InChIKey | XOTJVEUNJFTTFX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |