About 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine
2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine (PubChem CID 62162372) has the molecular formula C6H9F2N3O
and a molecular weight of 177.15 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine.
Molecular Properties
| Compound Name | 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine |
| PubChem CID | 62162372 |
| Molecular Formula | C6H9F2N3O |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine |
| SMILES | CNCCc1nnc(C(F)F)o1 |
| InChI | InChI=1S/C6H9F2N3O/c1-9-3-2-4-10-11-6(12-4)5(7)8/h5,9H,2-3H2,1H3 |
| InChIKey | SOPUIFVKPVPLKN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine?
The IUPAC name of 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine (CID 62162372) is 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine.
What is the SMILES notation for 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine?
The canonical SMILES for 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine is CNCCc1nnc(C(F)F)o1.
What is the InChIKey of 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine?
The InChIKey is SOPUIFVKPVPLKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2N3O/c1-9-3-2-4-10-11-6(12-4)5(7)8/h5,9H,2-3H2,1H3.
What are the key properties of 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine?
2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine has a molecular weight of 177.15 g/mol, XLogP of 0.77, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-methylethanamine is sourced from PubChem (CID 62162372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).