C8H15N3O — CID 62162393
N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine (PubChem CID 62162393) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 62162393 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNCCc1nnc(C)o1 |
| InChI | InChI=1S/C8H15N3O/c1-3-5-9-6-4-8-11-10-7(2)12-8/h9H,3-6H2,1-2H3 |
| InChIKey | ZVSLQJVFZIEHPP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|