About 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide
2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide (PubChem CID 62162458) has the molecular formula C9H11N5O2S2
and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide.
Molecular Properties
| Compound Name | 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide |
| PubChem CID | 62162458 |
| Molecular Formula | C9H11N5O2S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide |
| SMILES | CCNc1cc(S(=O)(=O)Nc2nncs2)ccn1 |
| InChI | InChI=1S/C9H11N5O2S2/c1-2-10-8-5-7(3-4-11-8)18(15,16)14-9-13-12-6-17-9/h3-6H,2H2,1H3,(H,10,11)(H,13,14) |
| InChIKey | CVFRLZWQAKUVRH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide?
The IUPAC name of 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide (CID 62162458) is 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide.
What is the SMILES notation for 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide?
The canonical SMILES for 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide is CCNc1cc(S(=O)(=O)Nc2nncs2)ccn1.
What is the InChIKey of 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide?
The InChIKey is CVFRLZWQAKUVRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O2S2/c1-2-10-8-5-7(3-4-11-8)18(15,16)14-9-13-12-6-17-9/h3-6H,2H2,1H3,(H,10,11)(H,13,14).
What are the key properties of 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide?
2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide has a molecular weight of 285.35 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-N-(1,3,4-thiadiazol-2-yl)pyridine-4-sulfonamide is sourced from PubChem (CID 62162458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).