C13H18N4O2S — CID 62162787
3-(2-ethylpyrrolidin-1-yl)sulfonylimidazo[1,2-a]pyridin-2-amine (PubChem CID 62162787) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-(2-ethylpyrrolidin-1-yl)sulfonylimidazo[1,2-a]pyridin-2-amine.
| Compound Name | 3-(2-ethylpyrrolidin-1-yl)sulfonylimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 62162787 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-(2-ethylpyrrolidin-1-yl)sulfonylimidazo[1,2-a]pyridin-2-amine |
| SMILES | CCC1CCCN1S(=O)(=O)c1c(N)nc2ccccn12 |
| InChI | InChI=1S/C13H18N4O2S/c1-2-10-6-5-9-17(10)20(18,19)13-12(14)15-11-7-3-4-8-16(11)13/h3-4,7-8,10H,2,5-6,9,14H2,1H3 |
| InChIKey | UGOPLXJDHVQAID-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |