C13H16FN3O — CID 62162910
N-ethyl-2-[5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]ethanamine (PubChem CID 62162910) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is N-ethyl-2-[5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]ethanamine.
| Compound Name | N-ethyl-2-[5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 62162910 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-ethyl-2-[5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]ethanamine |
| SMILES | CCNCCc1nnc(Cc2ccccc2F)o1 |
| InChI | InChI=1S/C13H16FN3O/c1-2-15-8-7-12-16-17-13(18-12)9-10-5-3-4-6-11(10)14/h3-6,15H,2,7-9H2,1H3 |
| InChIKey | VZJUPRDKLQWCGO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|