C25H21N3O5 — CID 6216391
4-[2,5-dimethyl-3-[(Z)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]benzoic acid (PubChem CID 6216391) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 4-[2,5-dimethyl-3-[(Z)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 4-[2,5-dimethyl-3-[(Z)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 6216391 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-[2,5-dimethyl-3-[(Z)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]pyrrol-1-yl]benzoic acid |
| SMILES | Cc1ccccc1N1C(=O)NC(=O)/C(=C/c2cc(C)n(-c3ccc(C(=O)O)cc3)c2C)C1=O |
| InChI | InChI=1S/C25H21N3O5/c1-14-6-4-5-7-21(14)28-23(30)20(22(29)26-25(28)33)13-18-12-15(2)27(16(18)3)19-10-8-17(9-11-19)24(31)32/h4-13H,1-3H3,(H,31,32)(H,26,29,33)/b20-13- |
| InChIKey | CEVJXXJRLXGMKP-MOSHPQCFSA-N |
| XLogP | 3.77 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|