C14H17F2N3O2 — CID 62165008
N-[2-[5-[3-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]ethyl]propan-1-amine (PubChem CID 62165008) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[2-[5-[3-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]ethyl]propan-1-amine.
| Compound Name | N-[2-[5-[3-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 62165008 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[2-[5-[3-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]ethyl]propan-1-amine |
| SMILES | CCCNCCc1nnc(-c2cccc(OC(F)F)c2)o1 |
| InChI | InChI=1S/C14H17F2N3O2/c1-2-7-17-8-6-12-18-19-13(21-12)10-4-3-5-11(9-10)20-14(15)16/h3-5,9,14,17H,2,6-8H2,1H3 |
| InChIKey | QMNOTSNXBGMZRM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|