C18H22N2O — CID 62166423
N-(2,6-dimethylphenyl)-4-(propylamino)benzamide (PubChem CID 62166423) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-(propylamino)benzamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-(propylamino)benzamide |
|---|---|
| PubChem CID | 62166423 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-(propylamino)benzamide |
| SMILES | CCCNc1ccc(C(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-4-12-19-16-10-8-15(9-11-16)18(21)20-17-13(2)6-5-7-14(17)3/h5-11,19H,4,12H2,1-3H3,(H,20,21) |
| InChIKey | CDHXPZQRQIALAF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |