C14H12BrCl2N3O — CID 62166855
N-(4-bromo-2,6-dichlorophenyl)-2-(ethylamino)pyridine-4-carboxamide (PubChem CID 62166855) has the molecular formula C14H12BrCl2N3O and a molecular weight of 389.08 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)-2-(ethylamino)pyridine-4-carboxamide.
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)-2-(ethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62166855 |
| Molecular Formula | C14H12BrCl2N3O |
| Molecular Weight | 389.08 g/mol |
| Exact Mass | 386.95 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)-2-(ethylamino)pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)Nc2c(Cl)cc(Br)cc2Cl)ccn1 |
| InChI | InChI=1S/C14H12BrCl2N3O/c1-2-18-12-5-8(3-4-19-12)14(21)20-13-10(16)6-9(15)7-11(13)17/h3-7H,2H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | ROZNWDGSQLUPLS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |